C50H31N — CID 176639429
10-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene (PubChem CID 176639429) has the molecular formula C50H31N and a molecular weight of 649.83 g/mol. Its IUPAC name is 10-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene.
| Compound Name | 10-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene |
|---|---|
| PubChem CID | 176639429 |
| Molecular Formula | C50H31N |
| Molecular Weight | 649.83 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | 10-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3c(-c4ccccc4)cccc3-c3ccccc3)c3ccccc3c(-c3cc4c5ccccc5n5c6ccccc6c(c3)c45)c2c1[2H] |
| InChI | InChI=1S/C50H31N/c1-3-16-32(17-4-1)35-26-15-27-36(33-18-5-2-6-19-33)48(35)49-41-24-9-7-22-39(41)47(40-23-8-10-25-42(40)49)34-30-43-37-20-11-13-28-45(37)51-46-29-14-12-21-38(46)44(31-34)50(43)51/h1-31H/i7D,9D,22D,24D |
| InChIKey | LASRDZQHNIBTNC-AKYPHPGFSA-N |
| XLogP | 13.81 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.83 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|