C47H31N — CID 176639528
3-[7-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]naphthalen-2-yl]pyridine (PubChem CID 176639528) has the molecular formula C47H31N and a molecular weight of 613.80 g/mol. Its IUPAC name is 3-[7-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]naphthalen-2-yl]pyridine.
| Compound Name | 3-[7-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]naphthalen-2-yl]pyridine |
|---|---|
| PubChem CID | 176639528 |
| Molecular Formula | C47H31N |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | 3-[7-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]naphthalen-2-yl]pyridine |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3c(-c4ccccc4)cccc3-c3ccccc3)c3ccccc3c(-c3ccc4ccc(-c5cccnc5)cc4c3)c2c1[2H] |
| InChI | InChI=1S/C47H31N/c1-3-13-33(14-4-1)39-22-11-23-40(34-15-5-2-6-16-34)46(39)47-43-20-9-7-18-41(43)45(42-19-8-10-21-44(42)47)36-27-25-32-24-26-35(29-38(32)30-36)37-17-12-28-48-31-37/h1-31H/i7D,9D,18D,20D |
| InChIKey | BWYUYJQJGRCMEM-MCEMEEANSA-N |
| XLogP | 12.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|