C56H40Si — CID 176639452
triphenyl-[4-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]phenyl]silane (PubChem CID 176639452) has the molecular formula C56H40Si and a molecular weight of 745.05 g/mol. Its IUPAC name is triphenyl-[4-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]phenyl]silane.
| Compound Name | triphenyl-[4-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]phenyl]silane |
|---|---|
| PubChem CID | 176639452 |
| Molecular Formula | C56H40Si |
| Molecular Weight | 745.05 g/mol |
| Exact Mass | 744.32 |
| IUPAC Name | triphenyl-[4-[1,2,3,4-tetradeuterio-10-(2,6-diphenylphenyl)anthracen-9-yl]phenyl]silane |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3c(-c4ccccc4)cccc3-c3ccccc3)c3ccccc3c(-c3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)c2c1[2H] |
| InChI | InChI=1S/C56H40Si/c1-6-21-41(22-7-1)48-35-20-36-49(42-23-8-2-9-24-42)55(48)56-52-33-18-16-31-50(52)54(51-32-17-19-34-53(51)56)43-37-39-47(40-38-43)57(44-25-10-3-11-26-44,45-27-12-4-13-28-45)46-29-14-5-15-30-46/h1-40H/i16D,18D,31D,33D |
| InChIKey | RXDFBFXKMOXPGQ-KDEWYLQXSA-N |
| XLogP | 12.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.05 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|