C24H34O3 — CID 176639770
2,3,4,6-tetramethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione (PubChem CID 176639770) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is 2,3,4,6-tetramethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione.
| Compound Name | 2,3,4,6-tetramethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione |
|---|---|
| PubChem CID | 176639770 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2,3,4,6-tetramethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione |
| SMILES | CCCCCC1=C(C)C(=O)C2=C(OC(C)(CCC=C(C)C)C(C)=C2C)C1=O |
| InChI | InChI=1S/C24H34O3/c1-8-9-10-13-19-17(5)21(25)20-16(4)18(6)24(7,14-11-12-15(2)3)27-23(20)22(19)26/h12H,8-11,13-14H2,1-7H3 |
| InChIKey | WKBMWGGXWXJCFF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|