C24H34O3 — CID 11417377
(5S,8R)-2,5-dimethyl-8-[(2S,4E)-6-methylhepta-4,6-dien-2-yl]-3-[(2-methylpropan-2-yl)oxy]-5,6,7,8-tetrahydronaphthalene-1,4-dione (PubChem CID 11417377) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is (5S,8R)-2,5-dimethyl-8-[(2S,4E)-6-methylhepta-4,6-dien-2-yl]-3-[(2-methylpropan-2-yl)oxy]-5,6,7,8-tetrahydronaphthalene-1,4-dione.
| Compound Name | (5S,8R)-2,5-dimethyl-8-[(2S,4E)-6-methylhepta-4,6-dien-2-yl]-3-[(2-methylpropan-2-yl)oxy]-5,6,7,8-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 11417377 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (5S,8R)-2,5-dimethyl-8-[(2S,4E)-6-methylhepta-4,6-dien-2-yl]-3-[(2-methylpropan-2-yl)oxy]-5,6,7,8-tetrahydronaphthalene-1,4-dione |
| SMILES | C=C(C)/C=C/C[C@H](C)[C@H]1CC[C@H](C)C2=C1C(=O)C(C)=C(OC(C)(C)C)C2=O |
| InChI | InChI=1S/C24H34O3/c1-14(2)10-9-11-15(3)18-13-12-16(4)19-20(18)21(25)17(5)23(22(19)26)27-24(6,7)8/h9-10,15-16,18H,1,11-13H2,2-8H3/b10-9+/t15-,16-,18+/m0/s1 |
| InChIKey | WYYGSBPVMUKYIC-RSHFNIINSA-N |
| XLogP | 5.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|