About 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol
2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 176657865) has the molecular formula C12H18O5
and a molecular weight of 242.27 g/mol. Its IUPAC name is 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 176657865 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | C=CCOC1C2COC(O2)C(OCC=C)C1O |
| InChI | InChI=1S/C12H18O5/c1-3-5-14-10-8-7-16-12(17-8)11(9(10)13)15-6-4-2/h3-4,8-13H,1-2,5-7H2 |
| InChIKey | DEGSXTZBVBGDPQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol (CID 176657865) is 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol is C=CCOC1C2COC(O2)C(OCC=C)C1O.
What is the InChIKey of 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol?
The InChIKey is DEGSXTZBVBGDPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O5/c1-3-5-14-10-8-7-16-12(17-8)11(9(10)13)15-6-4-2/h3-4,8-13H,1-2,5-7H2.
What are the key properties of 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol?
2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol has a molecular weight of 242.27 g/mol, XLogP of 0.24, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(prop-2-enoxy)-6,8-dioxabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 176657865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).