C11H25N3O — CID 176659037
(4S)-4,7-diamino-2-(butylamino)heptan-3-one (PubChem CID 176659037) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is (4S)-4,7-diamino-2-(butylamino)heptan-3-one.
| Compound Name | (4S)-4,7-diamino-2-(butylamino)heptan-3-one |
|---|---|
| PubChem CID | 176659037 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | (4S)-4,7-diamino-2-(butylamino)heptan-3-one |
| SMILES | CCCCNC(C)C(=O)[C@@H](N)CCCN |
| InChI | InChI=1S/C11H25N3O/c1-3-4-8-14-9(2)11(15)10(13)6-5-7-12/h9-10,14H,3-8,12-13H2,1-2H3/t9?,10-/m0/s1 |
| InChIKey | IQUPKWWLKBWGRC-AXDSSHIGSA-N |
| XLogP | 0.40 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|