C20H17ClFN3O3S — CID 176664691
[5-(1-cyclohexyl-6-nitroindazole-3-carbonyl)-2-fluorophenyl] thiohypochlorite (PubChem CID 176664691) has the molecular formula C20H17ClFN3O3S and a molecular weight of 433.89 g/mol. Its IUPAC name is [5-(1-cyclohexyl-6-nitroindazole-3-carbonyl)-2-fluorophenyl] thiohypochlorite.
| Compound Name | [5-(1-cyclohexyl-6-nitroindazole-3-carbonyl)-2-fluorophenyl] thiohypochlorite |
|---|---|
| PubChem CID | 176664691 |
| Molecular Formula | C20H17ClFN3O3S |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | [5-(1-cyclohexyl-6-nitroindazole-3-carbonyl)-2-fluorophenyl] thiohypochlorite |
| SMILES | O=C(c1ccc(F)c(SCl)c1)c1nn(C2CCCCC2)c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C20H17ClFN3O3S/c21-29-18-10-12(6-9-16(18)22)20(26)19-15-8-7-14(25(27)28)11-17(15)24(23-19)13-4-2-1-3-5-13/h6-11,13H,1-5H2 |
| InChIKey | OFNGXFQAGHZQFC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|