C23H23FN4O5S — CID 176664749
(1-cyclopentyl-6-nitroindazol-3-yl)-[3-(3-fluoro-3-methylazetidin-1-yl)sulfonylphenyl]methanone (PubChem CID 176664749) has the molecular formula C23H23FN4O5S and a molecular weight of 486.53 g/mol. Its IUPAC name is (1-cyclopentyl-6-nitroindazol-3-yl)-[3-(3-fluoro-3-methylazetidin-1-yl)sulfonylphenyl]methanone.
| Compound Name | (1-cyclopentyl-6-nitroindazol-3-yl)-[3-(3-fluoro-3-methylazetidin-1-yl)sulfonylphenyl]methanone |
|---|---|
| PubChem CID | 176664749 |
| Molecular Formula | C23H23FN4O5S |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (1-cyclopentyl-6-nitroindazol-3-yl)-[3-(3-fluoro-3-methylazetidin-1-yl)sulfonylphenyl]methanone |
| SMILES | CC1(F)CN(S(=O)(=O)c2cccc(C(=O)c3nn(C4CCCC4)c4cc([N+](=O)[O-])ccc34)c2)C1 |
| InChI | InChI=1S/C23H23FN4O5S/c1-23(24)13-26(14-23)34(32,33)18-8-4-5-15(11-18)22(29)21-19-10-9-17(28(30)31)12-20(19)27(25-21)16-6-2-3-7-16/h4-5,8-12,16H,2-3,6-7,13-14H2,1H3 |
| InChIKey | XJAJOVYXQBYRJD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 115.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|