C22H20F2N4O5S — CID 176664760
(1-cyclopentyl-6-nitroindazol-3-yl)-[3-(3,3-difluoroazetidin-1-yl)sulfonylphenyl]methanone (PubChem CID 176664760) has the molecular formula C22H20F2N4O5S and a molecular weight of 490.49 g/mol. Its IUPAC name is (1-cyclopentyl-6-nitroindazol-3-yl)-[3-(3,3-difluoroazetidin-1-yl)sulfonylphenyl]methanone.
| Compound Name | (1-cyclopentyl-6-nitroindazol-3-yl)-[3-(3,3-difluoroazetidin-1-yl)sulfonylphenyl]methanone |
|---|---|
| PubChem CID | 176664760 |
| Molecular Formula | C22H20F2N4O5S |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | (1-cyclopentyl-6-nitroindazol-3-yl)-[3-(3,3-difluoroazetidin-1-yl)sulfonylphenyl]methanone |
| SMILES | O=C(c1cccc(S(=O)(=O)N2CC(F)(F)C2)c1)c1nn(C2CCCC2)c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C22H20F2N4O5S/c23-22(24)12-26(13-22)34(32,33)17-7-3-4-14(10-17)21(29)20-18-9-8-16(28(30)31)11-19(18)27(25-20)15-5-1-2-6-15/h3-4,7-11,15H,1-2,5-6,12-13H2 |
| InChIKey | PTGHGWSXDCYRFX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 115.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|