C24H27FN4O5S — CID 176664768
N-tert-butyl-5-(1-cyclohexyl-6-nitroindazole-3-carbonyl)-2-fluorobenzenesulfonamide (PubChem CID 176664768) has the molecular formula C24H27FN4O5S and a molecular weight of 502.57 g/mol. Its IUPAC name is N-tert-butyl-5-(1-cyclohexyl-6-nitroindazole-3-carbonyl)-2-fluorobenzenesulfonamide.
| Compound Name | N-tert-butyl-5-(1-cyclohexyl-6-nitroindazole-3-carbonyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 176664768 |
| Molecular Formula | C24H27FN4O5S |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | N-tert-butyl-5-(1-cyclohexyl-6-nitroindazole-3-carbonyl)-2-fluorobenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cc(C(=O)c2nn(C3CCCCC3)c3cc([N+](=O)[O-])ccc23)ccc1F |
| InChI | InChI=1S/C24H27FN4O5S/c1-24(2,3)27-35(33,34)21-13-15(9-12-19(21)25)23(30)22-18-11-10-17(29(31)32)14-20(18)28(26-22)16-7-5-4-6-8-16/h9-14,16,27H,4-8H2,1-3H3 |
| InChIKey | LTEXBFBWWZPQDE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|