C14H28N2O4 — CID 176672908
2-methoxypropyl 2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoate (PubChem CID 176672908) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-methoxypropyl 2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoate.
| Compound Name | 2-methoxypropyl 2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 176672908 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-methoxypropyl 2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoate |
| SMILES | COC(C)COC(=O)C(NC(=O)C(N)C(C)C)C(C)C |
| InChI | InChI=1S/C14H28N2O4/c1-8(2)11(15)13(17)16-12(9(3)4)14(18)20-7-10(5)19-6/h8-12H,7,15H2,1-6H3,(H,16,17) |
| InChIKey | YEMMDYAPQLISIG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |