C22H32N2O7 — CID 176672885
2-[2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoyl]oxypropyl 4-acetyloxybenzoate (PubChem CID 176672885) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoyl]oxypropyl 4-acetyloxybenzoate.
| Compound Name | 2-[2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoyl]oxypropyl 4-acetyloxybenzoate |
|---|---|
| PubChem CID | 176672885 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-[2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoyl]oxypropyl 4-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccc(C(=O)OCC(C)OC(=O)C(NC(=O)C(N)C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C22H32N2O7/c1-12(2)18(23)20(26)24-19(13(3)4)22(28)30-14(5)11-29-21(27)16-7-9-17(10-8-16)31-15(6)25/h7-10,12-14,18-19H,11,23H2,1-6H3,(H,24,26) |
| InChIKey | GRFJNJMSRVVQOT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|