C22H36N2O6 — CID 177339941
4-methoxybenzaldehyde;2-methoxypropyl 2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoate (PubChem CID 177339941) has the molecular formula C22H36N2O6 and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-methoxybenzaldehyde;2-methoxypropyl 2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoate.
| Compound Name | 4-methoxybenzaldehyde;2-methoxypropyl 2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 177339941 |
| Molecular Formula | C22H36N2O6 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 4-methoxybenzaldehyde;2-methoxypropyl 2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoate |
| SMILES | COC(C)COC(=O)C(NC(=O)C(N)C(C)C)C(C)C.COc1ccc(C=O)cc1 |
| InChI | InChI=1S/C14H28N2O4.C8H8O2/c1-8(2)11(15)13(17)16-12(9(3)4)14(18)20-7-10(5)19-6;1-10-8-4-2-7(6-9)3-5-8/h8-12H,7,15H2,1-6H3,(H,16,17);2-6H,1H3 |
| InChIKey | VPEQEHQBBUTODA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|