C17H39NO3 — CID 176679206
N-(2-butan-2-yloxyethyl)-2-methyl-2-(propoxymethyl)butanamide;ethane;molecular hydrogen (PubChem CID 176679206) has the molecular formula C17H39NO3 and a molecular weight of 305.50 g/mol. Its IUPAC name is N-(2-butan-2-yloxyethyl)-2-methyl-2-(propoxymethyl)butanamide;ethane;molecular hydrogen.
| Compound Name | N-(2-butan-2-yloxyethyl)-2-methyl-2-(propoxymethyl)butanamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 176679206 |
| Molecular Formula | C17H39NO3 |
| Molecular Weight | 305.50 g/mol |
| Exact Mass | 305.29 |
| IUPAC Name | N-(2-butan-2-yloxyethyl)-2-methyl-2-(propoxymethyl)butanamide;ethane;molecular hydrogen |
| SMILES | CC.CCCOCC(C)(CC)C(=O)NCCOC(C)CC.[H][H] |
| InChI | InChI=1S/C15H31NO3.C2H6.H2/c1-6-10-18-12-15(5,8-3)14(17)16-9-11-19-13(4)7-2;1-2;/h13H,6-12H2,1-5H3,(H,16,17);1-2H3;1H |
| InChIKey | FBBIUZXNRXNRMW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|