C15H32N2O3 — CID 176679314
3-(3-amino-2,2-dimethylpropoxy)-3-methyl-N-(2-propan-2-yloxyethyl)butanamide (PubChem CID 176679314) has the molecular formula C15H32N2O3 and a molecular weight of 288.43 g/mol. Its IUPAC name is 3-(3-amino-2,2-dimethylpropoxy)-3-methyl-N-(2-propan-2-yloxyethyl)butanamide.
| Compound Name | 3-(3-amino-2,2-dimethylpropoxy)-3-methyl-N-(2-propan-2-yloxyethyl)butanamide |
|---|---|
| PubChem CID | 176679314 |
| Molecular Formula | C15H32N2O3 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | 3-(3-amino-2,2-dimethylpropoxy)-3-methyl-N-(2-propan-2-yloxyethyl)butanamide |
| SMILES | CC(C)OCCNC(=O)CC(C)(C)OCC(C)(C)CN |
| InChI | InChI=1S/C15H32N2O3/c1-12(2)19-8-7-17-13(18)9-15(5,6)20-11-14(3,4)10-16/h12H,7-11,16H2,1-6H3,(H,17,18) |
| InChIKey | VNDODIIPAUHCLR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|