About [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium
[4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium (PubChem CID 176679991) has the molecular formula C15H20ClFmN2OS-
and a molecular weight of 568.86 g/mol. Its IUPAC name is [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium.
Molecular Properties
| Compound Name | [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium |
| PubChem CID | 176679991 |
| Molecular Formula | C15H20ClFmN2OS- |
| Molecular Weight | 568.86 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium |
| SMILES | CC(C)(C)Sc1cccc(N2CCN([C-]=O)CC2)c1Cl.[Fm] |
| InChI | InChI=1S/C15H20ClN2OS.Fm/c1-15(2,3)20-13-6-4-5-12(14(13)16)18-9-7-17(11-19)8-10-18;/h4-6H,7-10H2,1-3H3;/q-1; |
| InChIKey | TYXVYWPJTSFEJB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 568.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium?
The IUPAC name of [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium (CID 176679991) is [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium.
What is the SMILES notation for [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium?
The canonical SMILES for [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium is CC(C)(C)Sc1cccc(N2CCN([C-]=O)CC2)c1Cl.[Fm].
What is the InChIKey of [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium?
The InChIKey is TYXVYWPJTSFEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClN2OS.Fm/c1-15(2,3)20-13-6-4-5-12(14(13)16)18-9-7-17(11-19)8-10-18;/h4-6H,7-10H2,1-3H3;/q-1;.
What are the key properties of [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium?
[4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium has a molecular weight of 568.86 g/mol, XLogP of 3.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-tert-butylsulfanyl-2-chlorophenyl)piperazin-1-yl]methanone;fermium is sourced from PubChem (CID 176679991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).