C38H17F2NO2S2 — CID 176682141
5,6-difluoro-2-[(15-phenyl-3,7-dithia-1-azaheptacyclo[12.9.2.02,9.04,8.010,25.017,24.018,23]pentacosa-2(9),4(8),5,10,12,14,16,18,20,22,24-undecaen-6-yl)methylidene]indene-1,3-dione (PubChem CID 176682141) has the molecular formula C38H17F2NO2S2 and a molecular weight of 621.69 g/mol. Its IUPAC name is 5,6-difluoro-2-[(15-phenyl-3,7-dithia-1-azaheptacyclo[12.9.2.02,9.04,8.010,25.017,24.018,23]pentacosa-2(9),4(8),5,10,12,14,16,18,20,22,24-undecaen-6-yl)methylidene]indene-1,3-dione.
| Compound Name | 5,6-difluoro-2-[(15-phenyl-3,7-dithia-1-azaheptacyclo[12.9.2.02,9.04,8.010,25.017,24.018,23]pentacosa-2(9),4(8),5,10,12,14,16,18,20,22,24-undecaen-6-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 176682141 |
| Molecular Formula | C38H17F2NO2S2 |
| Molecular Weight | 621.69 g/mol |
| Exact Mass | 621.07 |
| IUPAC Name | 5,6-difluoro-2-[(15-phenyl-3,7-dithia-1-azaheptacyclo[12.9.2.02,9.04,8.010,25.017,24.018,23]pentacosa-2(9),4(8),5,10,12,14,16,18,20,22,24-undecaen-6-yl)methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2cc3sc4c(c5cccc6c(-c7ccccc7)cc7c8ccccc8n4c7c65)c3s2)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C38H17F2NO2S2/c39-28-16-25-26(17-29(28)40)36(43)27(35(25)42)13-19-14-31-37(44-19)33-22-11-6-10-21-23(18-7-2-1-3-8-18)15-24-20-9-4-5-12-30(20)41(38(33)45-31)34(24)32(21)22/h1-17H |
| InChIKey | FIIFCAMHKBBYEL-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 38.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.69 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|