C36H17F2NO2S — CID 176682313
5,6-difluoro-2-[(13-phenyl-3-thia-1-azahexacyclo[9.9.2.02,6.07,22.014,21.015,20]docosa-2(6),4,7,9,11,13,15,17,19,21-decaen-4-yl)methylidene]indene-1,3-dione (PubChem CID 176682313) has the molecular formula C36H17F2NO2S and a molecular weight of 565.60 g/mol. Its IUPAC name is 5,6-difluoro-2-[(13-phenyl-3-thia-1-azahexacyclo[9.9.2.02,6.07,22.014,21.015,20]docosa-2(6),4,7,9,11,13,15,17,19,21-decaen-4-yl)methylidene]indene-1,3-dione.
| Compound Name | 5,6-difluoro-2-[(13-phenyl-3-thia-1-azahexacyclo[9.9.2.02,6.07,22.014,21.015,20]docosa-2(6),4,7,9,11,13,15,17,19,21-decaen-4-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 176682313 |
| Molecular Formula | C36H17F2NO2S |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | 5,6-difluoro-2-[(13-phenyl-3-thia-1-azahexacyclo[9.9.2.02,6.07,22.014,21.015,20]docosa-2(6),4,7,9,11,13,15,17,19,21-decaen-4-yl)methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2cc3c4cccc5cc(-c6ccccc6)c6c7ccccc7n(c3s2)c6c54)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C36H17F2NO2S/c37-28-16-24-25(17-29(28)38)35(41)27(34(24)40)15-20-14-26-21-11-6-9-19-13-23(18-7-2-1-3-8-18)32-22-10-4-5-12-30(22)39(36(26)42-20)33(32)31(19)21/h1-17H |
| InChIKey | OTSWVJPMCVHYIT-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 38.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|