C21H29NO2 — CID 176682640
tert-butyl 4-amino-3-(2-ethylphenyl)bicyclo[2.2.2]oct-2-ene-1-carboxylate (PubChem CID 176682640) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl 4-amino-3-(2-ethylphenyl)bicyclo[2.2.2]oct-2-ene-1-carboxylate.
| Compound Name | tert-butyl 4-amino-3-(2-ethylphenyl)bicyclo[2.2.2]oct-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 176682640 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | tert-butyl 4-amino-3-(2-ethylphenyl)bicyclo[2.2.2]oct-2-ene-1-carboxylate |
| SMILES | CCc1ccccc1C1=CC2(C(=O)OC(C)(C)C)CCC1(N)CC2 |
| InChI | InChI=1S/C21H29NO2/c1-5-15-8-6-7-9-16(15)17-14-20(18(23)24-19(2,3)4)10-12-21(17,22)13-11-20/h6-9,14H,5,10-13,22H2,1-4H3 |
| InChIKey | OUGPCQRTEFPZTD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |