C13H17F2NO4 — CID 176684273
4-benzyl-2,2-difluoro-5-(hydroxymethyl)-6-methylmorpholine-3,3-diol (PubChem CID 176684273) has the molecular formula C13H17F2NO4 and a molecular weight of 289.28 g/mol. Its IUPAC name is 4-benzyl-2,2-difluoro-5-(hydroxymethyl)-6-methylmorpholine-3,3-diol.
| Compound Name | 4-benzyl-2,2-difluoro-5-(hydroxymethyl)-6-methylmorpholine-3,3-diol |
|---|---|
| PubChem CID | 176684273 |
| Molecular Formula | C13H17F2NO4 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-benzyl-2,2-difluoro-5-(hydroxymethyl)-6-methylmorpholine-3,3-diol |
| SMILES | CC1OC(F)(F)C(O)(O)N(Cc2ccccc2)C1CO |
| InChI | InChI=1S/C13H17F2NO4/c1-9-11(8-17)16(7-10-5-3-2-4-6-10)13(18,19)12(14,15)20-9/h2-6,9,11,17-19H,7-8H2,1H3 |
| InChIKey | NXTVUFOXJZXCAB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|