C11H21N — CID 176684574
1,3,5-triethyl-3,6-dihydro-2H-pyridine (PubChem CID 176684574) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 1,3,5-triethyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1,3,5-triethyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 176684574 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 1,3,5-triethyl-3,6-dihydro-2H-pyridine |
| SMILES | CCC1=CC(CC)CN(CC)C1 |
| InChI | InChI=1S/C11H21N/c1-4-10-7-11(5-2)9-12(6-3)8-10/h7,10H,4-6,8-9H2,1-3H3 |
| InChIKey | UBEVVSICHBAUSQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|