About [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium
[butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium (PubChem CID 176693510) has the molecular formula C13H33N2Y-
and a molecular weight of 306.33 g/mol. Its IUPAC name is [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium.
Molecular Properties
| Compound Name | [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium |
| PubChem CID | 176693510 |
| Molecular Formula | C13H33N2Y- |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium |
| SMILES | CC.CC.CCCCN(C[N-]C)C(C)C.[Y] |
| InChI | InChI=1S/C9H21N2.2C2H6.Y/c1-5-6-7-11(8-10-4)9(2)3;2*1-2;/h9H,5-8H2,1-4H3;2*1-2H3;/q-1;;; |
| InChIKey | WDXVDWIPGQBTRB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium?
The IUPAC name of [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium (CID 176693510) is [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium.
What is the SMILES notation for [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium?
The canonical SMILES for [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium is CC.CC.CCCCN(C[N-]C)C(C)C.[Y].
What is the InChIKey of [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium?
The InChIKey is WDXVDWIPGQBTRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N2.2C2H6.Y/c1-5-6-7-11(8-10-4)9(2)3;2*1-2;/h9H,5-8H2,1-4H3;2*1-2H3;/q-1;;;.
What are the key properties of [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium?
[butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium has a molecular weight of 306.33 g/mol, XLogP of 4.51, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [butyl(propan-2-yl)amino]methyl-methylazanide;ethane;yttrium is sourced from PubChem (CID 176693510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).