C10H19NO4 — CID 176698160
(2R,4R,6S)-6-methyl-4-[(3R)-3-oxoniomorpholin-4-yl]oxan-2-olate (PubChem CID 176698160) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is (2R,4R,6S)-6-methyl-4-[(3R)-3-oxoniomorpholin-4-yl]oxan-2-olate.
| Compound Name | (2R,4R,6S)-6-methyl-4-[(3R)-3-oxoniomorpholin-4-yl]oxan-2-olate |
|---|---|
| PubChem CID | 176698160 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (2R,4R,6S)-6-methyl-4-[(3R)-3-oxoniomorpholin-4-yl]oxan-2-olate |
| SMILES | C[C@H]1C[C@@H](N2CCOC[C@H]2[OH2+])C[C@H]([O-])O1 |
| InChI | InChI=1S/C10H18NO4/c1-7-4-8(5-10(13)15-7)11-2-3-14-6-9(11)12/h7-10,12H,2-6H2,1H3/q-1/p+1/t7-,8+,9+,10+/m0/s1 |
| InChIKey | JQAJZARRXYUWFB-SGIHWFKDSA-O |
| XLogP | -1.38 |
| TPSA | 67.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|