C17H23N3O4 — CID 176698435
ethane;6-hydroxy-2-methoxy-5-methyl-8-methylidene-3-nitroso-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 176698435) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is ethane;6-hydroxy-2-methoxy-5-methyl-8-methylidene-3-nitroso-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | ethane;6-hydroxy-2-methoxy-5-methyl-8-methylidene-3-nitroso-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 176698435 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethane;6-hydroxy-2-methoxy-5-methyl-8-methylidene-3-nitroso-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | C=C1CC2C(O)N(C)c3cc(N=O)c(OC)cc3C(=O)N2C1.CC |
| InChI | InChI=1S/C15H17N3O4.C2H6/c1-8-4-12-15(20)17(2)11-6-10(16-21)13(22-3)5-9(11)14(19)18(12)7-8;1-2/h5-6,12,15,20H,1,4,7H2,2-3H3;1-2H3 |
| InChIKey | WHCNCAVCXBJNLF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|