C25H21F2N2O3P — CID 176698697
5-[4-[difluoro(phosphanyl)methyl]phenoxy]-N-(2-hydroxy-1-pyridin-2-ylethyl)naphthalene-2-carboxamide (PubChem CID 176698697) has the molecular formula C25H21F2N2O3P and a molecular weight of 466.42 g/mol. Its IUPAC name is 5-[4-[difluoro(phosphanyl)methyl]phenoxy]-N-(2-hydroxy-1-pyridin-2-ylethyl)naphthalene-2-carboxamide.
| Compound Name | 5-[4-[difluoro(phosphanyl)methyl]phenoxy]-N-(2-hydroxy-1-pyridin-2-ylethyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 176698697 |
| Molecular Formula | C25H21F2N2O3P |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 5-[4-[difluoro(phosphanyl)methyl]phenoxy]-N-(2-hydroxy-1-pyridin-2-ylethyl)naphthalene-2-carboxamide |
| SMILES | O=C(NC(CO)c1ccccn1)c1ccc2c(Oc3ccc(C(F)(F)P)cc3)cccc2c1 |
| InChI | InChI=1S/C25H21F2N2O3P/c26-25(27,33)18-8-10-19(11-9-18)32-23-6-3-4-16-14-17(7-12-20(16)23)24(31)29-22(15-30)21-5-1-2-13-28-21/h1-14,22,30H,15,33H2,(H,29,31) |
| InChIKey | COCCDESTAXDVLL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|