C29H30F2NO2P — CID 176698757
5-[4-[difluoro(phosphanyl)methyl]phenoxy]-N-[(3Z,4Z,6Z)-3-propylideneocta-4,6-dien-2-yl]naphthalene-2-carboxamide (PubChem CID 176698757) has the molecular formula C29H30F2NO2P and a molecular weight of 493.53 g/mol. Its IUPAC name is 5-[4-[difluoro(phosphanyl)methyl]phenoxy]-N-[(3Z,4Z,6Z)-3-propylideneocta-4,6-dien-2-yl]naphthalene-2-carboxamide.
| Compound Name | 5-[4-[difluoro(phosphanyl)methyl]phenoxy]-N-[(3Z,4Z,6Z)-3-propylideneocta-4,6-dien-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 176698757 |
| Molecular Formula | C29H30F2NO2P |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 5-[4-[difluoro(phosphanyl)methyl]phenoxy]-N-[(3Z,4Z,6Z)-3-propylideneocta-4,6-dien-2-yl]naphthalene-2-carboxamide |
| SMILES | C/C=C\C=C/C(=C/CC)C(C)NC(=O)c1ccc2c(Oc3ccc(C(F)(F)P)cc3)cccc2c1 |
| InChI | InChI=1S/C29H30F2NO2P/c1-4-6-7-10-21(9-5-2)20(3)32-28(33)23-13-18-26-22(19-23)11-8-12-27(26)34-25-16-14-24(15-17-25)29(30,31)35/h4,6-20H,5,35H2,1-3H3,(H,32,33)/b6-4-,10-7-,21-9- |
| InChIKey | BAKATOFFDPDLFV-SMWPADFFSA-N |
| XLogP | 8.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|