C17H34BN2O2 — CID 176701672
CID 176701672 (PubChem CID 176701672) has the molecular formula C17H34BN2O2 and a molecular weight of 309.28 g/mol.
| Compound Name | CID 176701672 |
|---|---|
| PubChem CID | 176701672 |
| Molecular Formula | C17H34BN2O2 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | — |
| SMILES | CC.CC.CNc1ccc([B]OC(C)(C)C(C)(C)O)cc1N |
| InChI | InChI=1S/C13H22BN2O2.2C2H6/c1-12(2,17)13(3,4)18-14-9-6-7-11(16-5)10(15)8-9;2*1-2/h6-8,16-17H,15H2,1-5H3;2*1-2H3 |
| InChIKey | MDXLLNXQKUAMMO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|