C12H9F4NO2 — CID 176704798
4,5,6,7-tetrafluoro-2-propyl-1a,7b-dihydrooxireno[2,3-c]isoquinolin-3-one (PubChem CID 176704798) has the molecular formula C12H9F4NO2 and a molecular weight of 275.20 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-2-propyl-1a,7b-dihydrooxireno[2,3-c]isoquinolin-3-one.
| Compound Name | 4,5,6,7-tetrafluoro-2-propyl-1a,7b-dihydrooxireno[2,3-c]isoquinolin-3-one |
|---|---|
| PubChem CID | 176704798 |
| Molecular Formula | C12H9F4NO2 |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 4,5,6,7-tetrafluoro-2-propyl-1a,7b-dihydrooxireno[2,3-c]isoquinolin-3-one |
| SMILES | CCCN1C(=O)c2c(F)c(F)c(F)c(F)c2C2OC21 |
| InChI | InChI=1S/C12H9F4NO2/c1-2-3-17-11(18)5-4(10-12(17)19-10)6(13)8(15)9(16)7(5)14/h10,12H,2-3H2,1H3 |
| InChIKey | GXPVYFUOPGSWCA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|