C14H23NO — CID 176706084
[(2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpiperidin-4-yl]methanol (PubChem CID 176706084) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is [(2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpiperidin-4-yl]methanol.
| Compound Name | [(2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 176706084 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | [(2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpiperidin-4-yl]methanol |
| SMILES | C=C/C=C(\C=C)CN1CC[C@@H](CO)C[C@H]1C |
| InChI | InChI=1S/C14H23NO/c1-4-6-13(5-2)10-15-8-7-14(11-16)9-12(15)3/h4-6,12,14,16H,1-2,7-11H2,3H3/b13-6+/t12-,14-/m1/s1 |
| InChIKey | MWEQJWUEPOVNAI-ZLZWCUCMSA-N |
| XLogP | 2.38 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|