C15H27NO — CID 178142444
ethane;[1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol (PubChem CID 178142444) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;[1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol.
| Compound Name | ethane;[1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 178142444 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | ethane;[1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol |
| SMILES | C=C/C(=C\C(=C)C)N1CCC(CO)CC1.CC |
| InChI | InChI=1S/C13H21NO.C2H6/c1-4-13(9-11(2)3)14-7-5-12(10-15)6-8-14;1-2/h4,9,12,15H,1-2,5-8,10H2,3H3;1-2H3/b13-9+; |
| InChIKey | OPGZOTWEPXJPBH-KJEVSKRMSA-N |
| XLogP | 3.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|