C25H25N4O6S+ — CID 176708724
[(2R,3R)-3-carboxyoxiran-2-yl]-oxo-[2-[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoyl]hydrazinyl]azanium (PubChem CID 176708724) has the molecular formula C25H25N4O6S+ and a molecular weight of 509.56 g/mol. Its IUPAC name is [(2R,3R)-3-carboxyoxiran-2-yl]-oxo-[2-[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoyl]hydrazinyl]azanium.
| Compound Name | [(2R,3R)-3-carboxyoxiran-2-yl]-oxo-[2-[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoyl]hydrazinyl]azanium |
|---|---|
| PubChem CID | 176708724 |
| Molecular Formula | C25H25N4O6S+ |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | [(2R,3R)-3-carboxyoxiran-2-yl]-oxo-[2-[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoyl]hydrazinyl]azanium |
| SMILES | C[C@@H](NC(=O)c1ccccc1CCC(=O)NN[N+](=O)[C@@H]1O[C@H]1C(=O)O)c1cccc(-c2cccs2)c1 |
| InChI | InChI=1S/C25H24N4O6S/c1-15(17-7-4-8-18(14-17)20-10-5-13-36-20)26-23(31)19-9-3-2-6-16(19)11-12-21(30)27-28-29(34)24-22(35-24)25(32)33/h2-10,13-15,22,24H,11-12H2,1H3,(H3-,26,27,28,30,31,32,33,34)/p+1/t15-,22-,24-/m1/s1 |
| InChIKey | ROJVLQRYFZAAGM-PKAUSPCKSA-O |
| XLogP | 2.96 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|