C26H26N4O5S — CID 176708627
methyl (E)-4-oxo-4-[2-[3-[2-[[(1R)-1-(5-thiophen-2-yl-3-pyridinyl)ethyl]carbamoyl]phenyl]propanoyl]hydrazinyl]but-2-enoate (PubChem CID 176708627) has the molecular formula C26H26N4O5S and a molecular weight of 506.58 g/mol. Its IUPAC name is methyl (E)-4-oxo-4-[2-[3-[2-[[(1R)-1-(5-thiophen-2-yl-3-pyridinyl)ethyl]carbamoyl]phenyl]propanoyl]hydrazinyl]but-2-enoate.
| Compound Name | methyl (E)-4-oxo-4-[2-[3-[2-[[(1R)-1-(5-thiophen-2-yl-3-pyridinyl)ethyl]carbamoyl]phenyl]propanoyl]hydrazinyl]but-2-enoate |
|---|---|
| PubChem CID | 176708627 |
| Molecular Formula | C26H26N4O5S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | methyl (E)-4-oxo-4-[2-[3-[2-[[(1R)-1-(5-thiophen-2-yl-3-pyridinyl)ethyl]carbamoyl]phenyl]propanoyl]hydrazinyl]but-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)NNC(=O)CCc1ccccc1C(=O)N[C@H](C)c1cncc(-c2cccs2)c1 |
| InChI | InChI=1S/C26H26N4O5S/c1-17(19-14-20(16-27-15-19)22-8-5-13-36-22)28-26(34)21-7-4-3-6-18(21)9-10-23(31)29-30-24(32)11-12-25(33)35-2/h3-8,11-17H,9-10H2,1-2H3,(H,28,34)(H,29,31)(H,30,32)/b12-11+/t17-/m1/s1 |
| InChIKey | WIOAMGMVRXDCLJ-FMQWLBJXSA-N |
| XLogP | 3.11 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|