C27H27N3O6S — CID 176708679
methyl (2R)-3-[[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoylamino]carbamoyl]oxirane-2-carboxylate (PubChem CID 176708679) has the molecular formula C27H27N3O6S and a molecular weight of 521.60 g/mol. Its IUPAC name is methyl (2R)-3-[[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoylamino]carbamoyl]oxirane-2-carboxylate.
| Compound Name | methyl (2R)-3-[[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoylamino]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 176708679 |
| Molecular Formula | C27H27N3O6S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | methyl (2R)-3-[[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoylamino]carbamoyl]oxirane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1OC1C(=O)NNC(=O)CCc1ccccc1C(=O)N[C@H](C)c1cccc(-c2cccs2)c1 |
| InChI | InChI=1S/C27H27N3O6S/c1-16(18-8-5-9-19(15-18)21-11-6-14-37-21)28-25(32)20-10-4-3-7-17(20)12-13-22(31)29-30-26(33)23-24(36-23)27(34)35-2/h3-11,14-16,23-24H,12-13H2,1-2H3,(H,28,32)(H,29,31)(H,30,33)/t16-,23?,24-/m1/s1 |
| InChIKey | LIFDWZNHPIUMPG-SBNQMUDOSA-N |
| XLogP | 2.93 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|