C34H40N4O5S — CID 176708676
N-[4-[4-amino-2-[[(1R)-1-[3-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]phenyl]ethyl]carbamoyl]phenyl]-2-oxobutyl]-3-(1-methoxyethenyl)oxirane-2-carboxamide (PubChem CID 176708676) has the molecular formula C34H40N4O5S and a molecular weight of 616.78 g/mol. Its IUPAC name is N-[4-[4-amino-2-[[(1R)-1-[3-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]phenyl]ethyl]carbamoyl]phenyl]-2-oxobutyl]-3-(1-methoxyethenyl)oxirane-2-carboxamide.
| Compound Name | N-[4-[4-amino-2-[[(1R)-1-[3-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]phenyl]ethyl]carbamoyl]phenyl]-2-oxobutyl]-3-(1-methoxyethenyl)oxirane-2-carboxamide |
|---|---|
| PubChem CID | 176708676 |
| Molecular Formula | C34H40N4O5S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | N-[4-[4-amino-2-[[(1R)-1-[3-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]phenyl]ethyl]carbamoyl]phenyl]-2-oxobutyl]-3-(1-methoxyethenyl)oxirane-2-carboxamide |
| SMILES | C=C(OC)C1OC1C(=O)NCC(=O)CCc1ccc(N)cc1C(=O)N[C@H](C)c1cccc(-c2ccc(CN3CCCC3)s2)c1 |
| InChI | InChI=1S/C34H40N4O5S/c1-21(24-7-6-8-25(17-24)30-14-13-28(44-30)20-38-15-4-5-16-38)37-33(40)29-18-26(35)11-9-23(29)10-12-27(39)19-36-34(41)32-31(43-32)22(2)42-3/h6-9,11,13-14,17-18,21,31-32H,2,4-5,10,12,15-16,19-20,35H2,1,3H3,(H,36,41)(H,37,40)/t21-,31?,32?/m1/s1 |
| InChIKey | FGTSSTLGZHICPO-AVAXFZJSSA-N |
| XLogP | 4.63 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|