C28H30N4O5S — CID 176708654
(2S,3S)-N,N-dimethyl-3-[[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoylamino]carbamoyl]oxirane-2-carboxamide (PubChem CID 176708654) has the molecular formula C28H30N4O5S and a molecular weight of 534.64 g/mol. Its IUPAC name is (2S,3S)-N,N-dimethyl-3-[[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoylamino]carbamoyl]oxirane-2-carboxamide.
| Compound Name | (2S,3S)-N,N-dimethyl-3-[[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoylamino]carbamoyl]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 176708654 |
| Molecular Formula | C28H30N4O5S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | (2S,3S)-N,N-dimethyl-3-[[3-[2-[[(1R)-1-(3-thiophen-2-ylphenyl)ethyl]carbamoyl]phenyl]propanoylamino]carbamoyl]oxirane-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1CCC(=O)NNC(=O)[C@H]1O[C@@H]1C(=O)N(C)C)c1cccc(-c2cccs2)c1 |
| InChI | InChI=1S/C28H30N4O5S/c1-17(19-9-6-10-20(16-19)22-12-7-15-38-22)29-26(34)21-11-5-4-8-18(21)13-14-23(33)30-31-27(35)24-25(37-24)28(36)32(2)3/h4-12,15-17,24-25H,13-14H2,1-3H3,(H,29,34)(H,30,33)(H,31,35)/t17-,24+,25+/m1/s1 |
| InChIKey | OSVWQEUTVSHEPZ-XATISFHKSA-N |
| XLogP | 2.84 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|