C21H20B6F3N3OS — CID 176711186
CID 176711186 (PubChem CID 176711186) has the molecular formula C21H20B6F3N3OS and a molecular weight of 484.34 g/mol.
| Compound Name | CID 176711186 |
|---|---|
| PubChem CID | 176711186 |
| Molecular Formula | C21H20B6F3N3OS |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])c1cc(N2CCc3nc(C(F)(F)F)sc3C2)cc(C([B])([B])[B])c1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C21H20B6F3N3OS/c1-18(2,3)8-15(34)32-16-11(19(22,23)24)6-10(7-12(16)20(25,26)27)33-5-4-13-14(9-33)35-17(31-13)21(28,29)30/h6-7H,4-5,8-9H2,1-3H3,(H,32,34) |
| InChIKey | VVHGKQQVRFTSHE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|