C33H44ClF2N5 — CID 176712597
4-chloro-1-fluoro-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-4'-(4-methylazepan-1-yl)spiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-2-amine (PubChem CID 176712597) has the molecular formula C33H44ClF2N5 and a molecular weight of 584.20 g/mol. Its IUPAC name is 4-chloro-1-fluoro-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-4'-(4-methylazepan-1-yl)spiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-2-amine.
| Compound Name | 4-chloro-1-fluoro-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-4'-(4-methylazepan-1-yl)spiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-2-amine |
|---|---|
| PubChem CID | 176712597 |
| Molecular Formula | C33H44ClF2N5 |
| Molecular Weight | 584.20 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | 4-chloro-1-fluoro-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-4'-(4-methylazepan-1-yl)spiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-2-amine |
| SMILES | CC1CCCN(c2nc(CCC34CCCN3CC(F)C4)nc3c2CCC2(CCCc4c(Cl)cc(N)c(F)c42)C3)CC1 |
| InChI | InChI=1S/C33H44ClF2N5/c1-21-5-3-14-40(16-9-21)31-24-7-12-32(10-2-6-23-25(34)17-26(37)30(36)29(23)32)19-27(24)38-28(39-31)8-13-33-11-4-15-41(33)20-22(35)18-33/h17,21-22H,2-16,18-20,37H2,1H3 |
| InChIKey | ZXJHRDWFZHLYSG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.20 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|