C33H45FN6 — CID 176712775
6-amino-3-[(2S)-butan-2-yl]-2-[2-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]-4-(2-methylpyrrolidin-1-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile (PubChem CID 176712775) has the molecular formula C33H45FN6 and a molecular weight of 544.76 g/mol. Its IUPAC name is 6-amino-3-[(2S)-butan-2-yl]-2-[2-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]-4-(2-methylpyrrolidin-1-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile.
| Compound Name | 6-amino-3-[(2S)-butan-2-yl]-2-[2-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]-4-(2-methylpyrrolidin-1-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile |
|---|---|
| PubChem CID | 176712775 |
| Molecular Formula | C33H45FN6 |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.37 |
| IUPAC Name | 6-amino-3-[(2S)-butan-2-yl]-2-[2-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]-4-(2-methylpyrrolidin-1-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile |
| SMILES | CC[C@H](C)c1ccc(N)c(C#N)c1C1CCc2c(nc(CC[C@@]34CCCN3CC(F)C4)nc2N2CCCC2C)C1 |
| InChI | InChI=1S/C33H45FN6/c1-4-21(2)25-10-11-28(36)27(19-35)31(25)23-8-9-26-29(17-23)37-30(38-32(26)40-16-5-7-22(40)3)12-14-33-13-6-15-39(33)20-24(34)18-33/h10-11,21-24H,4-9,12-18,20,36H2,1-3H3/t21-,22?,23?,24?,33+/m0/s1 |
| InChIKey | PCNXOHUDGMRIOJ-WMWQVRLPSA-N |
| XLogP | 6.21 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|