C38H59FN6 — CID 176712980
6-amino-3-butan-2-yl-2-[4-(2,2-diethylazetidin-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile;ethane;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 176712980) has the molecular formula C38H59FN6 and a molecular weight of 618.93 g/mol. Its IUPAC name is 6-amino-3-butan-2-yl-2-[4-(2,2-diethylazetidin-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile;ethane;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 6-amino-3-butan-2-yl-2-[4-(2,2-diethylazetidin-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile;ethane;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 176712980 |
| Molecular Formula | C38H59FN6 |
| Molecular Weight | 618.93 g/mol |
| Exact Mass | 618.48 |
| IUPAC Name | 6-amino-3-butan-2-yl-2-[4-(2,2-diethylazetidin-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile;ethane;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC.CC12CCCN1CC(F)C2.CCc1nc2c(c(N3CCC3(CC)CC)n1)CCC(c1c(C(C)CC)ccc(N)c1C#N)C2 |
| InChI | InChI=1S/C28H39N5.C8H14FN.C2H6/c1-6-18(5)20-12-13-23(30)22(17-29)26(20)19-10-11-21-24(16-19)31-25(7-2)32-27(21)33-15-14-28(33,8-3)9-4;1-8-3-2-4-10(8)6-7(9)5-8;1-2/h12-13,18-19H,6-11,14-16,30H2,1-5H3;7H,2-6H2,1H3;1-2H3 |
| InChIKey | YGLMLKAYGDLXNA-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.93 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|