C37H53FN6 — CID 176712343
6-amino-2-[2-ethyl-4-(6-propan-2-yl-2-azaspiro[3.3]heptan-2-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]-3-propylbenzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 176712343) has the molecular formula C37H53FN6 and a molecular weight of 600.87 g/mol. Its IUPAC name is 6-amino-2-[2-ethyl-4-(6-propan-2-yl-2-azaspiro[3.3]heptan-2-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]-3-propylbenzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 6-amino-2-[2-ethyl-4-(6-propan-2-yl-2-azaspiro[3.3]heptan-2-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]-3-propylbenzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 176712343 |
| Molecular Formula | C37H53FN6 |
| Molecular Weight | 600.87 g/mol |
| Exact Mass | 600.43 |
| IUPAC Name | 6-amino-2-[2-ethyl-4-(6-propan-2-yl-2-azaspiro[3.3]heptan-2-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]-3-propylbenzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC12CCCN1CC(F)C2.CCCc1ccc(N)c(C#N)c1C1CCc2c(nc(CC)nc2N2CC3(CC(C(C)C)C3)C2)C1 |
| InChI | InChI=1S/C29H39N5.C8H14FN/c1-5-7-19-9-11-24(31)23(15-30)27(19)20-8-10-22-25(12-20)32-26(6-2)33-28(22)34-16-29(17-34)13-21(14-29)18(3)4;1-8-3-2-4-10(8)6-7(9)5-8/h9,11,18,20-21H,5-8,10,12-14,16-17,31H2,1-4H3;7H,2-6H2,1H3 |
| InChIKey | FVROPUMGZKNNET-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.87 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|