C34H48FN5 — CID 176712313
6-amino-3-butan-2-yl-2-(4-cyclopentyl-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl)benzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 176712313) has the molecular formula C34H48FN5 and a molecular weight of 545.79 g/mol. Its IUPAC name is 6-amino-3-butan-2-yl-2-(4-cyclopentyl-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl)benzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 6-amino-3-butan-2-yl-2-(4-cyclopentyl-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl)benzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 176712313 |
| Molecular Formula | C34H48FN5 |
| Molecular Weight | 545.79 g/mol |
| Exact Mass | 545.39 |
| IUPAC Name | 6-amino-3-butan-2-yl-2-(4-cyclopentyl-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl)benzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC12CCCN1CC(F)C2.CCc1nc2c(c(C3CCCC3)n1)CCC(c1c(C(C)CC)ccc(N)c1C#N)C2 |
| InChI | InChI=1S/C26H34N4.C8H14FN/c1-4-16(3)19-12-13-22(28)21(15-27)25(19)18-10-11-20-23(14-18)29-24(5-2)30-26(20)17-8-6-7-9-17;1-8-3-2-4-10(8)6-7(9)5-8/h12-13,16-18H,4-11,14,28H2,1-3H3;7H,2-6H2,1H3 |
| InChIKey | JLARKUCIOYNPPH-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.79 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|