C32H47FN6 — CID 178025924
6-amino-2-[4-(diethylamino)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-3-propylbenzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 178025924) has the molecular formula C32H47FN6 and a molecular weight of 534.77 g/mol. Its IUPAC name is 6-amino-2-[4-(diethylamino)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-3-propylbenzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 6-amino-2-[4-(diethylamino)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-3-propylbenzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 178025924 |
| Molecular Formula | C32H47FN6 |
| Molecular Weight | 534.77 g/mol |
| Exact Mass | 534.38 |
| IUPAC Name | 6-amino-2-[4-(diethylamino)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-3-propylbenzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC12CCCN1CC(F)C2.CCCc1ccc(N)c(C#N)c1C1CCc2c(nc(CC)nc2N(CC)CC)C1 |
| InChI | InChI=1S/C24H33N5.C8H14FN/c1-5-9-16-11-13-20(26)19(15-25)23(16)17-10-12-18-21(14-17)27-22(6-2)28-24(18)29(7-3)8-4;1-8-3-2-4-10(8)6-7(9)5-8/h11,13,17H,5-10,12,14,26H2,1-4H3;7H,2-6H2,1H3 |
| InChIKey | OEAGQHQXUWUTEH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.77 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|