C33H41ClF2N6 — CID 176712807
1-[6-amino-8-chloro-5-fluoro-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]spiro[2,3-dihydro-1H-naphthalene-4,7'-6,8-dihydro-5H-quinazoline]-4'-yl]azepane-4-carbonitrile (PubChem CID 176712807) has the molecular formula C33H41ClF2N6 and a molecular weight of 595.18 g/mol. Its IUPAC name is 1-[6-amino-8-chloro-5-fluoro-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]spiro[2,3-dihydro-1H-naphthalene-4,7'-6,8-dihydro-5H-quinazoline]-4'-yl]azepane-4-carbonitrile.
| Compound Name | 1-[6-amino-8-chloro-5-fluoro-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]spiro[2,3-dihydro-1H-naphthalene-4,7'-6,8-dihydro-5H-quinazoline]-4'-yl]azepane-4-carbonitrile |
|---|---|
| PubChem CID | 176712807 |
| Molecular Formula | C33H41ClF2N6 |
| Molecular Weight | 595.18 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | 1-[6-amino-8-chloro-5-fluoro-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]spiro[2,3-dihydro-1H-naphthalene-4,7'-6,8-dihydro-5H-quinazoline]-4'-yl]azepane-4-carbonitrile |
| SMILES | N#CC1CCCN(c2nc(CCC34CCCN3CC(F)C4)nc3c2CCC2(CCCc4c(Cl)cc(N)c(F)c42)C3)CC1 |
| InChI | InChI=1S/C33H41ClF2N6/c34-25-16-26(38)30(36)29-23(25)5-1-9-32(29)11-6-24-27(18-32)39-28(7-12-33-10-3-14-42(33)20-22(35)17-33)40-31(24)41-13-2-4-21(19-37)8-15-41/h16,21-22H,1-15,17-18,20,38H2 |
| InChIKey | LXUZWQTUSXHZAZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.18 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|