C34H51F4N5 — CID 176712883
3-[[6-(3,3-difluoroazepan-1-yl)-2-ethyl-5-propylpyrimidin-4-yl]methyl]-2-fluoro-5-methyl-4-propylaniline;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 176712883) has the molecular formula C34H51F4N5 and a molecular weight of 605.81 g/mol. Its IUPAC name is 3-[[6-(3,3-difluoroazepan-1-yl)-2-ethyl-5-propylpyrimidin-4-yl]methyl]-2-fluoro-5-methyl-4-propylaniline;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 3-[[6-(3,3-difluoroazepan-1-yl)-2-ethyl-5-propylpyrimidin-4-yl]methyl]-2-fluoro-5-methyl-4-propylaniline;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 176712883 |
| Molecular Formula | C34H51F4N5 |
| Molecular Weight | 605.81 g/mol |
| Exact Mass | 605.41 |
| IUPAC Name | 3-[[6-(3,3-difluoroazepan-1-yl)-2-ethyl-5-propylpyrimidin-4-yl]methyl]-2-fluoro-5-methyl-4-propylaniline;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC12CCCN1CC(F)C2.CCCc1c(Cc2c(F)c(N)cc(C)c2CCC)nc(CC)nc1N1CCCCC(F)(F)C1 |
| InChI | InChI=1S/C26H37F3N4.C8H14FN/c1-5-10-18-17(4)14-21(30)24(27)20(18)15-22-19(11-6-2)25(32-23(7-3)31-22)33-13-9-8-12-26(28,29)16-33;1-8-3-2-4-10(8)6-7(9)5-8/h14H,5-13,15-16,30H2,1-4H3;7H,2-6H2,1H3 |
| InChIKey | FUBGFXVUUITRHO-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.81 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|