C15H24N2O3 — CID 176717453
[4-(aminomethyl)phenyl]methyl 2-methylpropanoate;propanamide (PubChem CID 176717453) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]methyl 2-methylpropanoate;propanamide.
| Compound Name | [4-(aminomethyl)phenyl]methyl 2-methylpropanoate;propanamide |
|---|---|
| PubChem CID | 176717453 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | [4-(aminomethyl)phenyl]methyl 2-methylpropanoate;propanamide |
| SMILES | CC(C)C(=O)OCc1ccc(CN)cc1.CCC(N)=O |
| InChI | InChI=1S/C12H17NO2.C3H7NO/c1-9(2)12(14)15-8-11-5-3-10(7-13)4-6-11;1-2-3(4)5/h3-6,9H,7-8,13H2,1-2H3;2H2,1H3,(H2,4,5) |
| InChIKey | LEGMNYBXSVGDEP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |