C22H26BN3O4 — CID 176719237
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carbonyl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyridin-4-one (PubChem CID 176719237) has the molecular formula C22H26BN3O4 and a molecular weight of 407.28 g/mol. Its IUPAC name is 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carbonyl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyridin-4-one.
| Compound Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carbonyl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyridin-4-one |
|---|---|
| PubChem CID | 176719237 |
| Molecular Formula | C22H26BN3O4 |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carbonyl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyridin-4-one |
| SMILES | CC1(C)OB(c2cccc3c2CCN3C(=O)c2cc3n(n2)CCCC3=O)OC1(C)C |
| InChI | InChI=1S/C22H26BN3O4/c1-21(2)22(3,4)30-23(29-21)15-7-5-8-17-14(15)10-12-25(17)20(28)16-13-18-19(27)9-6-11-26(18)24-16/h5,7-8,13H,6,9-12H2,1-4H3 |
| InChIKey | ULWNYHHNVPAGQK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|