C24H36N10 — CID 176723679
2-[3-[(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-cyclopropylpyrimidin-4-yl]azetidin-3-yl]acetonitrile (PubChem CID 176723679) has the molecular formula C24H36N10 and a molecular weight of 464.62 g/mol. Its IUPAC name is 2-[3-[(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-cyclopropylpyrimidin-4-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[3-[(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-cyclopropylpyrimidin-4-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 176723679 |
| Molecular Formula | C24H36N10 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | 2-[3-[(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-cyclopropylpyrimidin-4-yl]azetidin-3-yl]acetonitrile |
| SMILES | C/N=C/C(=C\N)Nc1ncc(C2CC2)c(N2CC(CC#N)(N3CCN4CCN(C)C[C@H]4C3)C2)n1 |
| InChI | InChI=1S/C24H36N10/c1-27-12-19(11-26)29-23-28-13-21(18-3-4-18)22(30-23)33-16-24(17-33,5-6-25)34-10-9-32-8-7-31(2)14-20(32)15-34/h11-13,18,20H,3-5,7-10,14-17,26H2,1-2H3,(H,28,29,30)/b19-11+,27-12+/t20-/m0/s1 |
| InChIKey | DLJHJFHIICRNSN-OHNDDRGCSA-N |
| XLogP | 0.67 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|