C50H38 — CID 176726774
9-[5-[1-(4-tert-butylphenyl)naphthalen-2-yl]naphthalen-1-yl]-1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracene (PubChem CID 176726774) has the molecular formula C50H38 and a molecular weight of 651.93 g/mol. Its IUPAC name is 9-[5-[1-(4-tert-butylphenyl)naphthalen-2-yl]naphthalen-1-yl]-1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracene.
| Compound Name | 9-[5-[1-(4-tert-butylphenyl)naphthalen-2-yl]naphthalen-1-yl]-1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracene |
|---|---|
| PubChem CID | 176726774 |
| Molecular Formula | C50H38 |
| Molecular Weight | 651.93 g/mol |
| Exact Mass | 651.38 |
| IUPAC Name | 9-[5-[1-(4-tert-butylphenyl)naphthalen-2-yl]naphthalen-1-yl]-1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cccc4c(-c5ccc6ccccc6c5-c5ccc(C(C)(C)C)cc5)cccc34)c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C50H38/c1-50(2,3)36-30-27-35(28-31-36)47-37-18-8-7-15-33(37)29-32-46(47)40-25-13-24-39-38(40)23-14-26-41(39)49-44-21-11-9-19-42(44)48(34-16-5-4-6-17-34)43-20-10-12-22-45(43)49/h4-32H,1-3H3/i4D,5D,6D,9D,10D,11D,12D,16D,17D,19D,20D,21D,22D |
| InChIKey | KOFRXSSZLBSXKC-WUKFUDSPSA-N |
| XLogP | 14.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.93 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|