C22H17FN2O2 — CID 176729772
3-[[(4-fluorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]amino]-1H-pyridin-4-one (PubChem CID 176729772) has the molecular formula C22H17FN2O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is 3-[[(4-fluorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]amino]-1H-pyridin-4-one.
| Compound Name | 3-[[(4-fluorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]amino]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 176729772 |
| Molecular Formula | C22H17FN2O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-[[(4-fluorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]amino]-1H-pyridin-4-one |
| SMILES | O=c1cc[nH]cc1NC(c1ccc(F)cc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C22H17FN2O2/c23-16-8-5-15(6-9-16)22(25-18-13-24-12-11-19(18)26)21-17-4-2-1-3-14(17)7-10-20(21)27/h1-13,22,25,27H,(H,24,26) |
| InChIKey | JZIGHIUMWGFWQX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|